What is the chemical name for P4S3?
Tetraphosphorus trisulfide PHOSPHORUS SESQUISULFIDE
| IUPAC Name | |
|---|---|
| Alternative Names | Tetraphosphorus trisulfide PHOSPHORUS SESQUISULFIDE Trisulfurated phosphorus Phosphorous sesquisulfide Tetraphosphorus trisulphide |
| Molecular Formula | P4S3 |
| Molar Mass | 220.075 g/mol |
| InChI | InChI=1S/P4S3/c5-1-2-3(1)7-4(5)6-2 |
What is the correct name for pcl5?
Phosphorus pentachloride
Phosphorus(V) chloride
Phosphorus pentachloride/IUPAC ID
What does P2S3 stand for?
Phosphorus sulfide (P2S3) Diphosphorus trisulphide. Phosphorus trisulfide.
What is P4S5 in chemistry?
Tetraphosphorus pentasulfide | P4S5 – PubChem.
What is the formula for lithium acetate?
C2H3LiO2Lithium acetate / Formula
What is C3N4 chemistry?
Cyanide nitrogen | C3N4 – PubChem.
What is the name of P4O6?
Phosphorus trioxide
Phosphorus trioxide is the chemical compound with the molecular formula P4O6. Although the molecular formula suggests the name tetraphosphorus hexoxide, the name phosphorus trioxide preceded the knowledge of the compound’s molecular structure, and its usage continues today.
What is the formula of Diphosphorus Trisulfide?
Molecular formula of diphosphorus trisulfide
| Compound Name | Molecular Formula | Molecular Weight |
|---|---|---|
| Diphosphorus Trisulfide | P2S3 | 158.14252 |
What is the compound P2S5 called?
Phosphorus(V) sulfide
Phosphorus(V) sulfide | P2S5 – PubChem.
What is the correct name for the formula P4S5?
Tetraphosphorus pentasulfide is the name of the compound of the given formula P4S5 .
Is P4S5 ionic or molecular?
Covalent compounds are also known as molecular compounds. They are made up of elements which are connected to each other by covalent bonds. Complete Step By Step Answer: The elements phosphorus and sulphur form the compound $ {P_4}{S_5} $ .