What is m-cresol used for?
Metacresol (m-cresol or 3-methylphenol) is colorless, yellowish liquid. It is used as a bactericide for control of crown gall and olive knot on certain fruit and nut trees and ornamentals and the genetic/physiological disorder burr knot on apples.
What is the structure of m-cresol?
C7H8Om-Cresol / Formula
What is the chemical nature of resorcinol?
Resorcinol is a benzenediol that is benzene dihydroxylated at positions 1 and 3. It has a role as an erythropoietin inhibitor and a sensitiser. It is a benzenediol and a member of resorcinols. Resorcinol is a 1,3-isomer (or meta-isomer) of benzenediol with the formula C6H4(OH)2.
What will be the major product when m-cresol is reacted with propargyl?
ethers
in presence of K2CO3. in acetone? Hint: The reaction in which meta-cresol reacts with propargyl bromide in the presence of \[{K_2}C{O_3}\] in acetone is a nucleophilic bimolecular reaction which gives ethers. Such a reaction is known as Williamson’s synthesis.
What is the IPC name of cresol?
Its IUPAC name is 3-methyl phenol.
Which of the following compound is m-cresol?
| IUPAC Name | 3-methylphenol |
|---|---|
| Alternative Names | m-cresol 3-methylphenol meta-cresol 3-hydroxytoluene m-methylphenol 3-cresol |
| Molecular Formula | C7H8O |
| Molar Mass | 108.14 g/mol |
| InChI | InChI=1S/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3 |
What is the category of cresol?
Category:Cresol
| group of chemical compounds general structure of isomers of cresol | |
|---|---|
| Upload media | |
| Instance of | group of ortho, meta, para isomers |
| Subclass of | cresol |
| Part of | cresol catabolic process (reactant), cresol metabolic process (participant) |